CAS 1236255-00-7

2-Piperidinecarboxamide, N-2-propen-1-yl-, hydrochloride (1:1)

Description:

2-Piperidinecarboxamide, N-2-propen-1-yl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the carboxamide functional group indicates that it has both amine and carbonyl characteristics, contributing to its potential as a bioactive molecule. The N-2-propen-1-yl substituent suggests that it has an allylic group, which may enhance its reactivity and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical applications. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₉H₁₆N₂O·ClH

InChI: InChI=1S/C9H16N2O.ClH/c1-2-6-11-9(12)8-5-3-4-7-10-8;/h2,8,10H,1,3-7H2,(H,11,12);1H

InChI key: InChIKey=KRNHZQVXXPBGCF-UHFFFAOYSA-N

SMILES: C(NCC=C)(=O)C1CCCCN1.Cl

Synonyms:

• 2-Piperidinecarboxamide, N-2-propen-1-yl-, hydrochloride (1:1)