CAS 1236255-22-3

2-Piperidinecarboxamide, N-(3-pyridinylmethyl)-, hydrochloride (1:1)

Description:

2-Piperidinecarboxamide, N-(3-pyridinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyridine moieties, which contribute to its potential biological activity. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The compound features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a pyridine ring, which is a five-membered aromatic ring with a nitrogen atom. These structural elements suggest that it may interact with various biological targets, potentially influencing neurotransmitter systems or exhibiting pharmacological properties. The hydrochloride form enhances its stability and solubility, making it suitable for various applications in medicinal chemistry and drug development. As with many nitrogen-containing compounds, it may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₁₂H₁₇N₃O·ClH

InChI: InChI=1S/C12H17N3O.ClH/c16-12(11-5-1-2-7-14-11)15-9-10-4-3-6-13-8-10;/h3-4,6,8,11,14H,1-2,5,7,9H2,(H,15,16);1H

InChI key: InChIKey=YSGZAJFDJUANIT-UHFFFAOYSA-N

SMILES: C(NCC=1C=CC=NC1)(=O)C2CCCCN2.Cl

Synonyms:

• 2-Piperidinecarboxamide, N-(3-pyridinylmethyl)-, hydrochloride (1:1)