CAS 1236255-46-1

8-Cyano-8-phenyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid

Description:

8-Cyano-8-phenyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid is a chemical compound characterized by its unique spirocyclic structure, which includes a thiazole and an azaspiro framework. The presence of a cyano group and a phenyl substituent contributes to its potential reactivity and biological activity. This compound features a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. The spiro structure often imparts interesting conformational properties, which can influence its interactions with biological targets. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be affected by environmental factors such as pH and temperature. Due to its structural complexity, 8-Cyano-8-phenyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₆H₁₈N₂O₂S

InChI: InChI=1S/C16H18N2O2S/c17-11-15(12-4-2-1-3-5-12)6-8-16(9-7-15)18-13(10-21-16)14(19)20/h1-5,13,18H,6-10H2,(H,19,20)

InChI key: InChIKey=XQDKVOAYAUWBNV-UHFFFAOYSA-N

SMILES: C(#N)C1(CCC2(CC1)NC(C(O)=O)CS2)C3=CC=CC=C3

Synonyms:

• 1-Thia-4-azaspiro[4.5]decane-3-carboxylic acid, 8-cyano-8-phenyl-
• 8-Cyano-8-phenyl-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid