CAS 1236256-49-7

Butanamide, 2-amino-N-(2-furanylmethyl)-3-methyl-, hydrochloride (1:1)

Description:

Butanamide, 2-amino-N-(2-furanylmethyl)-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a derivative of butanoic acid. The presence of the amino group suggests it may exhibit basic properties, while the furan ring contributes to its aromatic characteristics, potentially influencing its reactivity and solubility. The hydrochloride form indicates that the compound is a salt, which typically enhances its stability and solubility in water. This compound may be of interest in medicinal chemistry due to its structural features, which could impart biological activity. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further pharmacological studies. Additionally, the presence of both aliphatic and aromatic components may affect its lipophilicity and permeability, important factors in drug design. Overall, this compound's unique combination of functional groups and structural elements positions it as a potentially valuable substance in various chemical and pharmaceutical applications.

Formula: C₁₀H₁₆N₂O₂·ClH

InChI: InChI=1S/C10H16N2O2.ClH/c1-7(2)9(11)10(13)12-6-8-4-3-5-14-8;/h3-5,7,9H,6,11H2,1-2H3,(H,12,13);1H

InChI key: InChIKey=MWVCSSLHSCBEOV-UHFFFAOYSA-N

SMILES: C(NC(C(C(C)C)N)=O)C1=CC=CO1.Cl

Synonyms:

• Butanamide, 2-amino-N-(2-furanylmethyl)-3-methyl-, hydrochloride (1:1)