CAS 1236256-54-4

Propanamide, 2-amino-N-(4-methoxyphenyl)-, hydrochloride (1:1)

Description:

Propanamide, 2-amino-N-(4-methoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of the amino group indicates that it has basic properties, while the methoxyphenyl substituent contributes to its aromatic characteristics and may influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. This compound may exhibit biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways. Its molecular structure suggests that it could participate in hydrogen bonding due to the presence of both the amine and amide functionalities, which may affect its interaction with other molecules. Overall, the characteristics of this compound make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.

Formula: C₁₀H₁₄N₂O₂·ClH

InChI: InChI=1S/C10H14N2O2.ClH/c1-7(11)10(13)12-8-3-5-9(14-2)6-4-8;/h3-7H,11H2,1-2H3,(H,12,13);1H

InChI key: InChIKey=DMVRKDGGQULUAX-UHFFFAOYSA-N

SMILES: N(C(C(C)N)=O)C1=CC=C(OC)C=C1.Cl

Synonyms:

• Propanamide, 2-amino-N-(4-methoxyphenyl)-, hydrochloride (1:1)