
CAS 1236257-02-5
:Butanamide, 2-amino-3-methyl-N-(3-methylphenyl)-, hydrochloride (1:1)
Description:
Butanamide, 2-amino-3-methyl-N-(3-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential applications in pharmaceuticals and organic synthesis. The presence of an amino group suggests that it may exhibit basic properties, while the butanamide structure contributes to its solubility and stability in various solvents. The compound features a 3-methylphenyl substituent, which can influence its biological activity and interaction with other molecules. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and chemical applications. The compound's molecular structure suggests potential for use in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of more complex molecules. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the precise molecular interactions and the presence of functional groups, making it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C12H18N2O·ClH
InChI:InChI=1S/C12H18N2O.ClH/c1-8(2)11(13)12(15)14-10-6-4-5-9(3)7-10;/h4-8,11H,13H2,1-3H3,(H,14,15);1H
InChI key:InChIKey=ZJKBYYKUIWNDOX-UHFFFAOYSA-N
SMILES:N(C(C(C(C)C)N)=O)C1=CC(C)=CC=C1.Cl
Synonyms:- Butanamide, 2-amino-3-methyl-N-(3-methylphenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.