CAS 1236259-25-8

Benzenepropanamide, α-amino-N-butyl-N-methyl-, hydrochloride (1:1)

Description:

Benzenepropanamide, α-amino-N-butyl-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a benzene ring, which contributes to its aromatic properties. The presence of the α-amino group indicates that it is an amino acid derivative, which can participate in various biochemical interactions. The butyl and methyl substituents on the nitrogen atom suggest that it has hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting specific receptors or pathways. Its molecular structure allows for potential interactions with proteins and enzymes, which could be relevant in therapeutic contexts. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through experimental studies.

Formula: C₁₄H₂₂N₂O·ClH

InChI: InChI=1S/C14H22N2O.ClH/c1-3-4-10-16(2)14(17)13(15)11-12-8-6-5-7-9-12;/h5-9,13H,3-4,10-11,15H2,1-2H3;1H

InChI key: InChIKey=OLLUFBJDKBJMOC-UHFFFAOYSA-N

SMILES: C(C(C(N(CCCC)C)=O)N)C1=CC=CC=C1.Cl

Synonyms:

• Benzenepropanamide, α-amino-N-butyl-N-methyl-, hydrochloride (1:1)