CAS 1236259-26-9

2-Pyrrolidinecarboxamide, N-(3-methylphenyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinecarboxamide, N-(3-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a pyrrolidine ring, which contributes to its cyclic structure. The presence of the 3-methylphenyl group indicates that it has an aromatic component, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways, although specific pharmacological properties would require further investigation. Its molecular structure suggests it could participate in hydrogen bonding, affecting its interactions with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound's unique structural features position it as a candidate for research in medicinal chemistry and related fields.

Formula: C₁₂H₁₆N₂O·ClH

InChI: InChI=1S/C12H16N2O.ClH/c1-9-4-2-5-10(8-9)14-12(15)11-6-3-7-13-11;/h2,4-5,8,11,13H,3,6-7H2,1H3,(H,14,15);1H

InChI key: InChIKey=GNVRUWMQTMCSRR-UHFFFAOYSA-N

SMILES: C(NC1=CC(C)=CC=C1)(=O)C2CCCN2.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-(3-methylphenyl)-, hydrochloride (1:1)