CAS 1236261-21-4

2-Pyrrolidinecarboxamide, N-(3-methoxypropyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinecarboxamide, N-(3-methoxypropyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of the carboxamide functional group contributes to its potential as a polar molecule, influencing its solubility and reactivity. The methoxypropyl substituent enhances its hydrophilicity and may affect its biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, making it suitable for pharmaceutical applications. This compound may exhibit various biological activities, including potential effects on the central nervous system, due to the presence of the pyrrolidine moiety, which is often associated with neuroactive properties. Its specific applications and effects would depend on further pharmacological studies. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₉H₁₈N₂O₂·ClH

InChI: InChI=1S/C9H18N2O2.ClH/c1-13-7-3-6-11-9(12)8-4-2-5-10-8;/h8,10H,2-7H2,1H3,(H,11,12);1H

InChI key: InChIKey=HBRAGAOJSMMJTE-UHFFFAOYSA-N

SMILES: C(NCCCOC)(=O)C1CCCN1.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-(3-methoxypropyl)-, hydrochloride (1:1)