
CAS 1236261-25-8
:2-Pyrrolidinecarboxamide, N-(2-pyridinylmethyl)-, hydrochloride (1:1)
Description:
2-Pyrrolidinecarboxamide, N-(2-pyridinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a pyridine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for pharmaceutical applications. The presence of the hydrochloride salt form enhances its stability and solubility, which is advantageous for drug formulation. The compound may exhibit biological activity, potentially acting as a modulator or inhibitor in various biochemical pathways, although specific pharmacological properties would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C11H16ClN3O
InChI:InChI=1S/C11H15N3O.ClH/c15-11(10-5-3-7-13-10)14-8-9-4-1-2-6-12-9;/h1-2,4,6,10,13H,3,5,7-8H2,(H,14,15);1H
InChI key:InChIKey=YINAHOKCJMVHPF-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CC=N1)(=O)C2CCCN2.Cl
Synonyms:- 2-Pyrrolidinecarboxamide, N-(2-pyridinylmethyl)-, hydrochloride (1:1)
- N-(PYRIDIN-2-YLMETHYL)PYRROLIDINE-2-CARBOXAMIDE HYDROCHLORIDE
- N-(2-Pyridinylmethyl)-2-pyrrolidinecarboxamidehydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.