CAS 1236262-04-6

Methanone, (2-methyl-1-piperidinyl)-2-piperidinyl-, hydrochloride (1:1)

Description:

Methanone, (2-methyl-1-piperidinyl)-2-piperidinyl-, hydrochloride (1:1), also known by its CAS number 1236262-04-6, is a chemical compound characterized by its piperidine and methanone functional groups. This substance typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical contexts. The presence of piperidine rings suggests potential psychoactive properties, as piperidine derivatives are often explored for their effects on the central nervous system. The compound's molecular structure indicates it may exhibit basic properties due to the nitrogen atoms in the piperidine rings, which can participate in hydrogen bonding and interact with biological targets. As with many synthetic compounds, its safety profile, including toxicity and pharmacokinetics, would need to be thoroughly evaluated through research and clinical studies. Overall, this compound represents a specific class of organic molecules with potential applications in medicinal chemistry and drug development.

Formula: C₁₂H₂₂N₂O·ClH

InChI: InChI=1S/C12H22N2O.ClH/c1-10-6-3-5-9-14(10)12(15)11-7-2-4-8-13-11;/h10-11,13H,2-9H2,1H3;1H

InChI key: InChIKey=OFABYTPYJRAPIL-UHFFFAOYSA-N

SMILES: C(=O)(N1C(C)CCCC1)C2CCCCN2.Cl

Synonyms:

• Methanone, (2-methyl-1-piperidinyl)-2-piperidinyl-, hydrochloride (1:1)