CAS 1236262-34-2

2-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1)

Description:

2-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a butyl group attached to the nitrogen of the piperidine, contributing to its hydrophobic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the carboxamide functional group indicates potential for hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and form of the compound. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₂₀N₂O·ClH

InChI: InChI=1S/C10H20N2O.ClH/c1-2-3-7-12-10(13)9-6-4-5-8-11-9;/h9,11H,2-8H2,1H3,(H,12,13);1H

InChI key: InChIKey=BXULBLSTAPDDMZ-UHFFFAOYSA-N

SMILES: C(NCCCC)(=O)C1CCCCN1.Cl

Synonyms:

• 2-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1)