CAS 1236262-48-8

Benzenepropanamide, α-amino-N-(3-methylphenyl)-, hydrochloride (1:1)

Description:

Benzenepropanamide, α-amino-N-(3-methylphenyl)-, hydrochloride (1:1), with the CAS number 1236262-48-8, is a chemical compound characterized by its amide functional group and an amino group attached to a propanamide structure. This compound features a benzene ring and a 3-methylphenyl substituent, contributing to its aromatic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The presence of the amino group suggests potential biological activity, possibly as a neurotransmitter or in other biochemical pathways. Its molecular structure indicates that it may exhibit characteristics such as moderate polarity and the ability to form hydrogen bonds, which can influence its interactions in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature, making it important to consider these factors in practical applications.

Formula: C₁₆H₁₈N₂O·ClH

InChI: InChI=1S/C16H18N2O.ClH/c1-12-6-5-9-14(10-12)18-16(19)15(17)11-13-7-3-2-4-8-13;/h2-10,15H,11,17H2,1H3,(H,18,19);1H

InChI key: InChIKey=XPVSYSHUPIRBEU-UHFFFAOYSA-N

SMILES: N(C(C(CC1=CC=CC=C1)N)=O)C2=CC(C)=CC=C2.Cl

Synonyms:

• Benzenepropanamide, α-amino-N-(3-methylphenyl)-, hydrochloride (1:1)