CAS 1236262-90-0

2-Pyrrolidinecarboxamide, N-ethyl-N-(2-hydroxyethyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinecarboxamide, N-ethyl-N-(2-hydroxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a pyrrolidine ring, which contributes to its cyclic structure. The presence of the N-ethyl and N-(2-hydroxyethyl) substituents indicates that it has both ethyl and hydroxyethyl groups attached to the nitrogen atom of the amide, enhancing its solubility and potentially influencing its biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand or modulator in biological systems, although specific pharmacological effects would depend on further studies. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, which may affect its interaction with biological targets. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields.

Formula: C₉H₁₈N₂O₂·ClH

InChI: InChI=1S/C9H18N2O2.ClH/c1-2-11(6-7-12)9(13)8-4-3-5-10-8;/h8,10,12H,2-7H2,1H3;1H

InChI key: InChIKey=GIBHMTGGPKFOTB-UHFFFAOYSA-N

SMILES: C(N(CCO)CC)(=O)C1CCCN1.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-ethyl-N-(2-hydroxyethyl)-, hydrochloride (1:1)