CymitQuimica logo

CAS 1236262-91-1

:

Butanamide, 2-amino-3-methyl-N-(1-methylpropyl)-, hydrochloride (1:1)

Description:
Butanamide, 2-amino-3-methyl-N-(1-methylpropyl)-, hydrochloride (1:1), identified by the CAS number 1236262-91-1, is a chemical compound that belongs to the class of amides. It features a butanamide backbone with an amino group and a branched alkyl substituent, specifically a 1-methylpropyl group, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amino group suggests potential basicity, while the butanamide structure indicates it may exhibit characteristics typical of amides, such as moderate polarity and the ability to participate in hydrogen bonding. This compound may be of interest in medicinal chemistry due to its structural features, which could influence biological activity. However, specific details regarding its reactivity, stability, and potential applications would require further investigation and characterization through experimental studies.
Formula:C9H20N2O·ClH
InChI:InChI=1S/C9H20N2O.ClH/c1-5-7(4)11-9(12)8(10)6(2)3;/h6-8H,5,10H2,1-4H3,(H,11,12);1H
InChI key:InChIKey=IOCBYWWBHVBWFL-UHFFFAOYSA-N
SMILES:C(C(C(C)C)N)(NC(CC)C)=O.Cl
Synonyms:
  • Butanamide, 2-amino-3-methyl-N-(1-methylpropyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.