CAS 1236263-39-0

2-Pyrrolidinecarboxamide, N-butyl-N-methyl-, hydrochloride (1:1)

Description:

2-Pyrrolidinecarboxamide, N-butyl-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a pyrrolidine ring, which contributes to its cyclic structure. The presence of both butyl and methyl groups attached to the nitrogen atom of the amide enhances its lipophilicity, potentially influencing its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as moderate to high polarity due to the amide group, which can engage in hydrogen bonding. Its molecular structure suggests potential interactions with biological targets, which may be of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications in drug development.

Formula: C₁₀H₂₀N₂O·ClH

InChI: InChI=1S/C10H20N2O.ClH/c1-3-4-8-12(2)10(13)9-6-5-7-11-9;/h9,11H,3-8H2,1-2H3;1H

InChI key: InChIKey=PMVDPPFMGGSACD-UHFFFAOYSA-N

SMILES: C(N(CCCC)C)(=O)C1CCCN1.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-butyl-N-methyl-, hydrochloride (1:1)