CAS 1236264-30-4

2-Amino-1-(3-hydroxy-1-azetidinyl)-3-phenyl-1-propanone

Description:

2-Amino-1-(3-hydroxy-1-azetidinyl)-3-phenyl-1-propanone is a chemical compound characterized by its unique structural features, including an amino group, a hydroxyl group, and a phenyl group attached to a propanone backbone. The presence of the azetidine ring contributes to its cyclic structure, which can influence its reactivity and biological activity. This compound may exhibit properties typical of both amines and ketones, such as potential basicity and reactivity towards electrophiles. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents. Additionally, the phenyl group may provide aromatic characteristics, influencing the compound's stability and interaction with other molecules. Due to its structural complexity, this compound could have applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the azetidine or phenyl groups might lead to variations in biological activity. However, specific data regarding its toxicity, stability, and reactivity would require further investigation and experimental validation.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1S/C12H16N2O2/c13-11(6-9-4-2-1-3-5-9)12(16)14-7-10(15)8-14/h1-5,10-11,15H,6-8,13H2

InChI key: InChIKey=LFVXINNUOAXXAV-UHFFFAOYSA-N

SMILES: C(C(CC1=CC=CC=C1)N)(=O)N2CC(O)C2

Synonyms:

• 2-Amino-1-(3-hydroxy-1-azetidinyl)-3-phenyl-1-propanone
• 1-Propanone, 2-amino-1-(3-hydroxy-1-azetidinyl)-3-phenyl-