CAS 1236266-10-6

1-Butanone, 2-amino-3-methyl-1-(1-pyrrolidinyl)-, hydrochloride (1:1)

Description:

1-Butanone, 2-amino-3-methyl-1-(1-pyrrolidinyl)-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine and ketone functional groups. This substance features a butanone backbone with an amino group and a pyrrolidine ring, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The presence of the pyrrolidine moiety may suggest psychoactive properties, as many compounds with similar structures are known to interact with neurotransmitter systems. The compound's molecular structure indicates it may exhibit basicity due to the amino group, allowing it to form salts with acids. Its specific properties, such as melting point, boiling point, and solubility, would depend on the precise conditions and purity of the sample. Overall, this compound is of interest in medicinal chemistry and pharmacology, warranting further investigation into its potential therapeutic applications.

Formula: C₉H₁₈N₂O·ClH

InChI: InChI=1S/C9H18N2O.ClH/c1-7(2)8(10)9(12)11-5-3-4-6-11;/h7-8H,3-6,10H2,1-2H3;1H

InChI key: InChIKey=NOSWZVAQTQGCDW-UHFFFAOYSA-N

SMILES: C(C(C(C)C)N)(=O)N1CCCC1.Cl

Synonyms:

• 1-Butanone, 2-amino-3-methyl-1-(1-pyrrolidinyl)-, hydrochloride (1:1)

2-Amino-3-methyl-1-(pyrrolidin-1-yl)butan-1-one hydrochloride

CAS: 1236266-10-6

Versatile small molecule scaffold

Formula: C₉H₁₉ClN₂O

Purity: Min. 95%

Molecular weight: 206.71 g/mol

Ref: 3D-LZB26610