CAS 1236266-36-6

1-Butanone, 2-amino-1-(2-ethyl-1-piperidinyl)-3-methyl-, hydrochloride (1:1)

Description:

1-Butanone, 2-amino-1-(2-ethyl-1-piperidinyl)-3-methyl-, hydrochloride (1:1), with CAS number 1236266-36-6, is a chemical compound that features a butanone backbone modified with an amino group and a piperidine ring. This compound is typically characterized by its hydrochloride salt form, which enhances its solubility in water and may influence its pharmacological properties. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its structure indicates potential interactions with biological targets, making it of interest in drug design and development. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₂H₂₄N₂O·ClH

InChI: InChI=1S/C12H24N2O.ClH/c1-4-10-7-5-6-8-14(10)12(15)11(13)9(2)3;/h9-11H,4-8,13H2,1-3H3;1H

InChI key: InChIKey=QIVHQPUTLNOBPH-UHFFFAOYSA-N

SMILES: C(C(C(C)C)N)(=O)N1C(CC)CCCC1.Cl

Synonyms:

• 1-Butanone, 2-amino-1-(2-ethyl-1-piperidinyl)-3-methyl-, hydrochloride (1:1)