
CAS 1236267-77-8
:1-[(3-Methoxyphenyl)methyl]-4-oxo-2-azetidinecarboxylic acid
Description:
1-[(3-Methoxyphenyl)methyl]-4-oxo-2-azetidinecarboxylic acid is a chemical compound characterized by its unique azetidine ring structure, which is a four-membered cyclic amine. The presence of a methoxyphenyl group contributes to its aromatic properties, while the carboxylic acid functional group indicates its potential acidity and reactivity. The compound features a ketone group (4-oxo) that can participate in various chemical reactions, such as nucleophilic addition or condensation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the aromatic and carboxylic acid functionalities, which can influence biological activity. Additionally, the compound's solubility and stability may vary depending on the pH and solvent conditions, which are important factors to consider in its practical applications. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical synthesis and drug development.
Formula:C12H13NO4
InChI:InChI=1S/C12H13NO4/c1-17-9-4-2-3-8(5-9)7-13-10(12(15)16)6-11(13)14/h2-5,10H,6-7H2,1H3,(H,15,16)
InChI key:InChIKey=LROPNKFKMNMAKM-UHFFFAOYSA-N
SMILES:C(N1C(C(O)=O)CC1=O)C2=CC(OC)=CC=C2
Synonyms:- 1-[(3-Methoxyphenyl)methyl]-4-oxo-2-azetidinecarboxylic acid
- 2-Azetidinecarboxylic acid, 1-[(3-methoxyphenyl)methyl]-4-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.