CymitQuimica logo

CAS 1236285-22-5

:

4-Chloro-5-fluoro-7-[1-(5-methyl-2-pyrimidinyl)-4-piperidinyl]-7H-pyrrolo[2,3-d]pyrimidine

Description:
4-Chloro-5-fluoro-7-[1-(5-methyl-2-pyrimidinyl)-4-piperidinyl]-7H-pyrrolo[2,3-d]pyrimidine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes both pyrimidine and piperidine moieties. This compound features a chloro and a fluoro substituent, contributing to its unique chemical properties and potential biological activity. The presence of the piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure indicates potential for hydrogen bonding and lipophilicity, which can influence its solubility and permeability in biological systems. The compound's specific stereochemistry and functional groups may also play a crucial role in its pharmacodynamics and pharmacokinetics. As with many heterocyclic compounds, it may exhibit a range of activities, including anti-inflammatory or anti-cancer properties, warranting further investigation through experimental studies. Safety and handling precautions should be observed due to the presence of halogenated substituents, which can affect toxicity and environmental impact.
Formula:C16H16ClFN6
InChI:InChI=1S/C16H16ClFN6/c1-10-6-19-16(20-7-10)23-4-2-11(3-5-23)24-8-12(18)13-14(17)21-9-22-15(13)24/h6-9,11H,2-5H2,1H3
InChI key:InChIKey=QUBRFXXBYPZPAN-UHFFFAOYSA-N
SMILES:FC=1C=2C(N(C1)C3CCN(CC3)C=4N=CC(C)=CN4)=NC=NC2Cl
Synonyms:
  • 7H-Pyrrolo[2,3-d]pyrimidine, 4-chloro-5-fluoro-7-[1-(5-methyl-2-pyrimidinyl)-4-piperidinyl]-
  • 4-Chloro-5-fluoro-7-[1-(5-methyl-2-pyrimidinyl)-4-piperidinyl]-7H-pyrrolo[2,3-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.