CAS 1236306-08-3

Ethyl 3-chloro-4-pyridineacetate

Description:

Ethyl 3-chloro-4-pyridineacetate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the chloro substituent at the 3-position of the pyridine ring enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Ethyl 3-chloro-4-pyridineacetate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents like ethanol and dichloromethane but has limited solubility in water due to its hydrophobic ethyl group. This compound is of interest in medicinal chemistry and agrochemicals, where it may serve as an intermediate in the synthesis of biologically active molecules. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₉H₁₀ClNO₂

InChI: InChI=1S/C9H10ClNO2/c1-2-13-9(12)5-7-3-4-11-6-8(7)10/h3-4,6H,2,5H2,1H3

InChI key: InChIKey=PKHJNDLCWFYFHP-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C=1C(Cl)=CN=CC1

Synonyms:

• 4-Pyridineacetic acid, 3-chloro-, ethyl ester
• Ethyl 3-chloro-4-pyridineacetate

Ethyl 2-(3-chloropyridin-4-yl)acetate

CAS: 1236306-08-3

Versatile small molecule scaffold

Formula: C₉H₁₀ClNO₂

Purity: Min. 95%

Molecular weight: 199.63 g/mol

Ref: 3D-LZB30608