CAS 123637-97-8: (2-chloro-6-methylquinolin-3-yl)methanol
Description:(2-Chloro-6-methylquinolin-3-yl)methanol is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a chlorine atom at the 2-position and a methyl group at the 6-position of the quinoline ring contributes to its unique chemical properties. The hydroxymethyl group (-CH2OH) at the 3-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound may exhibit biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many halogenated compounds, it is essential to handle (2-chloro-6-methylquinolin-3-yl)methanol with care due to potential toxicity and environmental impact. Overall, its structural features suggest a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C11H10ClNO
InChI:InChI=1/C11H10ClNO/c1-7-2-3-10-8(4-7)5-9(6-14)11(12)13-10/h2-5,14H,6H2,1H3
- Synonyms:
- (2-Chloro-6-methyl-quinolin-3-yl)-methanol
- 3-Quinolinemethanol, 2-Chloro-6-Methyl-
- (2-Chloro-6-methylquinolin-3-yl)methanol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Quinolinemethanol, 2-chloro-6-methyl- REF: IN-DA000KWTCAS: 123637-97-8 | - - - | To inquire | Tue 04 Mar 25 |
![]() | 2-Chloro-6-methylquinoline-3-methanol REF: 54-OR309263CAS: 123637-97-8 | - - - | 349.00 €~800.00 € | Tue 11 Mar 25 |
![]() | 2-Chloro-6-methylquinoline-3-methanol REF: 3D-YEA63797CAS: 123637-97-8 | Min. 95% | To inquire | Tue 15 Apr 25 |
![]() | (2-Chloro-6-methylquinolin-3-yl)methanol REF: 10-F639865CAS: 123637-97-8 | 95+% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-Chloro-6-methylquinoline-3-methanol
Ref: 3D-YEA63797
5g | 1,190.00 € | ||
500mg | 471.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
(2-Chloro-6-methylquinolin-3-yl)methanol
Ref: 10-F639865
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |