CAS 123637-97-8
:(2-chloro-6-methylquinolin-3-yl)methanol
Description:
(2-Chloro-6-methylquinolin-3-yl)methanol is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a chlorine atom at the 2-position and a methyl group at the 6-position of the quinoline ring contributes to its unique chemical properties. The hydroxymethyl group (-CH2OH) at the 3-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound may exhibit biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many halogenated compounds, it is essential to handle (2-chloro-6-methylquinolin-3-yl)methanol with care due to potential toxicity and environmental impact. Overall, its structural features suggest a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C11H10ClNO
InChI:InChI=1/C11H10ClNO/c1-7-2-3-10-8(4-7)5-9(6-14)11(12)13-10/h2-5,14H,6H2,1H3
SMILES:Cc1ccc2c(c1)cc(CO)c(Cl)n2
Synonyms:- (2-Chloro-6-methyl-quinolin-3-yl)-methanol
- 3-Quinolinemethanol, 2-Chloro-6-Methyl-
- (2-Chloro-6-methylquinolin-3-yl)methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Chloro-6-methylquinoline-3-methanol
CAS:2-Chloro-6-methylquinoline-3-methanolPurity:≥95%Molecular weight:207.66g/mol2-Chloro-6-methylquinoline-3-methanol
CAS:2-Chloro-6-methylquinoline-3-methanol is a versatile compound that serves as a catalyst in various chemical reactions. It is particularly effective in facilitating the synthesis of glutamate, reactive carboxy intermediates, and metofluthrin. With its unique amide structure and c1-4 alkyl group, this compound acts as a solid catalyst for dehydrating cellulose and dichloride polymers. Its exceptional performance makes it an essential component in the field of research chemicals and industrial applications. Whether you're conducting experiments or developing new materials, 2-Chloro-6-methylquinoline-3-methanol is your go-to catalyst for reliable results.Formula:C11H10ClNOPurity:Min. 95%Molecular weight:207.66 g/mol


