
CAS 1236861-61-2
:2-(3-Azetidinyl)pyrimidine
Description:
2-(3-Azetidinyl)pyrimidine is a chemical compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The presence of a 3-azetidinyl group, a four-membered cyclic amine, at the 2-position of the pyrimidine ring contributes to its unique properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, possibly influencing various biochemical pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Additionally, its synthesis may involve specific organic reactions, such as cyclization or substitution, to achieve the desired structure. As with many heterocycles, 2-(3-Azetidinyl)pyrimidine could serve as a scaffold for further modifications, potentially leading to derivatives with enhanced pharmacological profiles. Safety and handling considerations are essential, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c1-2-9-7(10-3-1)6-4-8-5-6/h1-3,6,8H,4-5H2
InChI key:InChIKey=DEXFWXDNNACYDB-UHFFFAOYSA-N
SMILES:C1(CNC1)C=2N=CC=CN2
Synonyms:- 3-(Pyrimidin-2-yl)azetidine
- Pyrimidine, 2-(3-azetidinyl)-
- 2-(3-Azetidinyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.