
CAS 1236861-70-3: 2-(3-Azetidinyl)pyrazine
Description:2-(3-Azetidinyl)pyrazine is a chemical compound characterized by its unique structural features, which include a pyrazine ring and an azetidine substituent. The pyrazine moiety is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions, contributing to its basicity and potential for forming hydrogen bonds. The azetidine group, a four-membered saturated ring containing one nitrogen atom, introduces strain and can influence the compound's reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural characteristics, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of functional groups and the spatial arrangement of atoms, which can affect solubility, stability, and bioavailability. As with many nitrogen-containing heterocycles, 2-(3-Azetidinyl)pyrazine may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis and drug development.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c1-2-10-7(5-8-1)6-3-9-4-6/h1-2,5-6,9H,3-4H2
InChI key:InChIKey=GEYFEJGSJSORFG-UHFFFAOYSA-N
SMILES:N=1C=CN=C(C1)C2CNC2
- Synonyms:
- 2-(3-Azetidinyl)pyrazine
- Pyrazine, 2-(3-azetidinyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(Azetidin-3-yl)pyrazine REF: 10-F695073CAS: 1236861-70-3 | 95% | To inquire | Wed 23 Apr 25 |
![]() | 2-(AZETIDIN-3-YL)PYRAZINE REF: IN-DA00HHDUCAS: 1236861-70-3 | 95% | - - - | Discontinued product |
![]() | 2-(Azetidin-3-yl)pyrazine REF: 3D-LZB86170CAS: 1236861-70-3 | Min. 95% | - - - | Discontinued product |

Ref: 10-F695073
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

2-(AZETIDIN-3-YL)PYRAZINE
Ref: IN-DA00HHDU
1g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |

2-(Azetidin-3-yl)pyrazine
Ref: 3D-LZB86170
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |