
CAS 1236862-21-7
:Azetidine, 3-(3-methylphenoxy)-, hydrochloride (1:1)
Description:
Azetidine, 3-(3-methylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the 3-(3-methylphenoxy) substituent indicates that there is a phenoxy group attached to the azetidine at the third position, with a methyl group on the phenyl ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the presence of the hydrochloride group, which can also affect its pharmacokinetics and pharmacodynamics. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C10H13NO·ClH
InChI:InChI=1S/C10H13NO.ClH/c1-8-3-2-4-9(5-8)12-10-6-11-7-10;/h2-5,10-11H,6-7H2,1H3;1H
InChI key:InChIKey=KBYNVFRMORRMIO-UHFFFAOYSA-N
SMILES:O(C1=CC(C)=CC=C1)C2CNC2.Cl
Synonyms:- Azetidine, 3-(3-methylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.