CAS 1236862-22-8
:Azetidine, 3-(3-methoxyphenoxy)-, hydrochloride (1:1)
Description:
Azetidine, 3-(3-methoxyphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The compound features a 3-(3-methoxyphenoxy) substituent, indicating the presence of a methoxy group attached to a phenyl ring, which is further connected to the azetidine moiety through an ether linkage. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The presence of the hydrochloride group also suggests that the compound may exhibit improved stability and bioavailability. This compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to its unique structural features that could influence biological activity. However, specific biological properties, synthesis methods, and applications would require further investigation and research to fully understand its potential uses and effects.
Formula:C10H13NO2·ClH
InChI:InChI=1S/C10H13NO2.ClH/c1-12-8-3-2-4-9(5-8)13-10-6-11-7-10;/h2-5,10-11H,6-7H2,1H3;1H
InChI key:InChIKey=GLOLGWUKGPABEY-UHFFFAOYSA-N
SMILES:O(C1=CC(OC)=CC=C1)C2CNC2.Cl
Synonyms:- Azetidine, 3-(3-methoxyphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
