CAS 123690-79-9: P-(3-Aminopropyl)-P-(diethoxymethyl)phosphinic acid
Description:P-(3-Aminopropyl)-P-(diethoxymethyl)phosphinic acid is a phosphinic acid derivative characterized by the presence of both an amino group and diethoxymethyl substituents on the phosphorus atom. This compound typically exhibits properties associated with phosphinic acids, such as potential applications in agriculture as a plant growth regulator or in the synthesis of various organophosphorus compounds. The amino group can impart basicity and may participate in various chemical reactions, including nucleophilic substitutions. The diethoxymethyl groups enhance the compound's solubility in organic solvents and may influence its reactivity and stability. Additionally, the presence of phosphorus in its structure suggests potential utility in coordination chemistry and as a ligand in metal complexes. The compound's unique structure may also lead to specific biological activities, making it of interest in medicinal chemistry. Overall, P-(3-Aminopropyl)-P-(diethoxymethyl)phosphinic acid is a versatile chemical with potential applications across various fields, including agriculture, materials science, and pharmaceuticals.
Formula:C8H20NO4P
InChI:InChI=1S/C8H20NO4P/c1-3-12-8(13-4-2)14(10,11)7-5-6-9/h8H,3-7,9H2,1-2H3,(H,10,11)
InChI key:InChIKey=QIIVUOWTHWIXFO-UHFFFAOYSA-N
SMILES:O=P(O)(CCCN)C(OCC)OCC
- Synonyms:
- Cgp 35348
- P-(3-Aminopropyl)-P-(diethoxymethyl)phosphinic acid
- Phosphinic acid, (3-aminopropyl)(diethoxymethyl)-
- Phosphinic acid, P-(3-aminopropyl)-P-(diethoxymethyl)-
- (3-Aminopropyl)(diethoxymethyl)phosphinic acid

Phosphinic acid, P-(3-aminopropyl)-P-(diethoxymethyl)-
Ref: IN-DA000KYE
5mg | 255.00 € | ||
10mg | 592.00 € | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Ref: 54-BUP07178
1g | 2,582.00 € | ||
25mg | 473.00 € | ||
50mg | 750.00 € | ||
100mg | 1,106.00 € | ||
500mg | 1,921.00 € |

CGP 35348
Ref: TM-T21793
1mg | 52.00 € | ||
5mg | 97.00 € | ||
10mg | 160.00 € | ||
25mg | 311.00 € | ||
50mg | 502.00 € | ||
100mg | 753.00 € |

CGP 35348
Ref: 3D-YEA69079
10mg | 331.00 € | ||
25mg | 410.00 € | ||
50mg | 598.00 € | ||
100mg | 943.00 € | ||
250mg | 1,483.00 € |