CymitQuimica logo

CAS 123695-38-5

:

3-chloroisoquinoline-4-carboxylic acid

Description:
3-Chloroisoquinoline-4-carboxylic acid is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring. The presence of a carboxylic acid group (-COOH) at the 4-position and a chlorine atom at the 3-position of the isoquinoline ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The chlorine substituent can also affect the compound's electronic properties, potentially enhancing its biological activity. Additionally, 3-chloroisoquinoline-4-carboxylic acid may serve as a precursor for the synthesis of more complex molecules or as a building block in the development of pharmaceuticals, particularly in the field of drug discovery. Its unique structure and functional groups make it an interesting subject for research in both synthetic and medicinal chemistry.
Formula:C10H6ClNO2
InChI:InChI=1/C10H6ClNO2/c11-9-8(10(13)14)7-4-2-1-3-6(7)5-12-9/h1-5H,(H,13,14)
Synonyms:
  • 4-isoquinolinecarboxylic acid, 3-chloro-
  • 3-Chloroisoquinoline-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.