CAS 1237-53-2
:2-Chloro-4,6-bis(2,4-dimethylphenyl)-1,3,5-triazine
Description:
2-Chloro-4,6-bis(2,4-dimethylphenyl)-1,3,5-triazine, with CAS number 1237-53-2, is a chemical compound belonging to the triazine family, characterized by a six-membered aromatic ring containing three nitrogen atoms. This compound typically exhibits a pale yellow to white crystalline appearance and is known for its stability under various conditions. It is primarily utilized in the field of organic chemistry and materials science, particularly as a UV absorber and in the synthesis of other organic compounds. The presence of chlorine and dimethylphenyl groups contributes to its unique reactivity and solubility properties, making it useful in various applications, including coatings and plastics. Additionally, its structure allows for potential interactions with other chemical species, which can be exploited in various chemical reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, 2-Chloro-4,6-bis(2,4-dimethylphenyl)-1,3,5-triazine is a significant compound in both industrial and research settings.
Formula:C19H18ClN3
InChI:InChI=1S/C19H18ClN3/c1-11-5-7-15(13(3)9-11)17-21-18(23-19(20)22-17)16-8-6-12(2)10-14(16)4/h5-10H,1-4H3
InChI key:InChIKey=LVWOBZPDFCTAOU-UHFFFAOYSA-N
SMILES:CC1=C(C=2N=C(N=C(Cl)N2)C3=C(C)C=C(C)C=C3)C=CC(C)=C1
Synonyms:- 2-Chloro-4,6-bis(2′,4′-dimethylphenyl)-1,3,5-triazine
- 1,3,5-triazine, 2-chloro-4,6-bis(2,4-dimethylphenyl)-
- 2-Chloro-4,6-bis(2,4-dimethylphenyl)-1,3,5-triazine
- s-Triazine, 2-chloro-4,6-di-2,4-xylyl-
- 1,3,5-Triazine, 2-chloro-4,6-bis(2,4-dimethylphenyl)-
- 2-Chloro-4,6-bis(2,4-dimethylphenyl)-1,3,5-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,5-Triazine, 2-chloro-4,6-bis(2,4-dimethylphenyl)-
CAS:Formula:C19H18ClN3Molecular weight:323.8193
