CAS 123702-94-3

2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 8-(2,4-dihydroxyphenyl)-7,8-dihydro-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)-

Description:

2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 8-(2,4-dihydroxyphenyl)-7,8-dihydro-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)-, identified by CAS number 123702-94-3, is a complex organic compound characterized by its polycyclic structure, which includes fused benzene and pyran rings. This compound features multiple functional groups, including hydroxyl (-OH) groups and a methyl group, contributing to its potential reactivity and solubility in various solvents. The presence of the 2,4-dihydroxyphenyl moiety suggests possible antioxidant properties, while the aliphatic side chain may influence its biological activity and interaction with other molecules. The compound's structural complexity indicates potential applications in fields such as pharmaceuticals, where it may exhibit bioactive properties. Its synthesis and stability would depend on specific reaction conditions, and its behavior in biological systems would require further investigation to elucidate its mechanisms of action and potential therapeutic uses.

Formula: C₂₅H₂₆O₆

InChI: InChI=1S/C25H26O6/c1-14(2)5-4-8-25(3)13-21(29)18-10-17-20(28)11-22(30-23(17)12-24(18)31-25)16-7-6-15(26)9-19(16)27/h5-7,9-10,12-13,22,26-27,29H,4,8,11H2,1-3H3

InChI key: InChIKey=NFBQENQRKMAZCZ-UHFFFAOYSA-N

SMILES: OC=1C2=C(OC(CCC=C(C)C)(C)C1)C=C3C(=C2)C(=O)CC(O3)C4=C(O)C=C(O)C=C4

Synonyms:

• 2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 8-(2,4-dihydroxyphenyl)-7,8-dihydro-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)-
• Kuwanol C
• 2H,6H-Benzo[1,2-b:5,4-b']dipyran-6-one, 8-(2,4-dihydroxyphenyl)-7,8-dihydro-5-hydroxy-2-methyl-2-(4-methyl-3-pentenyl)- (9CI)

Kuwanol C

CAS: 123702-94-3

Kuwanol C is a natural product from Morus alba L.

Formula: C₂₅H₂₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 422.47

Ref: TM-TN4401

Kuwanol C

CAS: 123702-94-3

Formula: C₂₅H₂₆O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 422.477

Ref: BP-SBP02752

Kuwanol C

CAS: 123702-94-3

Kuwanol C is a flavonoid derivative, which is a naturally occurring compound extracted from the roots of Morus alba, commonly known as white mulberry. This product functions as an inhibitor of tyrosinase activity, a key enzyme involved in the biosynthesis of melanin. Tyrosinase catalyzes the oxidation of monophenols to o-diphenols and further to o-quinones, leading to melanin production. Kuwanol C's mode of action involves binding to the active site of tyrosinase, thereby reducing its catalytic capabilities and subsequent melanin synthesis.

Formula: C₂₅H₂₆O₆

Purity: Min. 95%

Molecular weight: 422.5 g/mol

Ref: 3D-YEA70294