CAS 123706-69-4
:19,19-Bis(4-methoxyphenyl)-19-phenyl-3,6,9,12,15,18-hexaoxanonadecan-1-ol
Description:
19,19-Bis(4-methoxyphenyl)-19-phenyl-3,6,9,12,15,18-hexaoxanonadecan-1-ol, with CAS number 123706-69-4, is a synthetic organic compound characterized by its long aliphatic chain and multiple ether linkages. This compound features a central nonadecane backbone that is heavily substituted with phenyl and methoxyphenyl groups, which contribute to its unique chemical properties. The presence of the hexaoxa moiety indicates that it contains six ether linkages, enhancing its solubility in organic solvents and potentially imparting interesting surfactant properties. The methoxy groups can influence the compound's polarity and reactivity, making it suitable for various applications in materials science and organic synthesis. Additionally, the hydroxyl group at one end of the molecule may participate in hydrogen bonding, affecting its physical properties such as melting point and solubility. Overall, this compound's structural features suggest potential utility in fields such as polymer chemistry, drug delivery systems, and as a building block for more complex organic molecules.
Formula:C33H44O9
InChI:InChI=1S/C33H44O9/c1-35-31-12-8-29(9-13-31)33(28-6-4-3-5-7-28,30-10-14-32(36-2)15-11-30)42-27-26-41-25-24-40-23-22-39-21-20-38-19-18-37-17-16-34/h3-15,34H,16-27H2,1-2H3
InChI key:InChIKey=TZXARFLYKYWWKC-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOCCO)(C1=CC=C(OC)C=C1)(C2=CC=C(OC)C=C2)C3=CC=CC=C3
Synonyms:- 19,19-Bis(4-methoxyphenyl)-19-phenyl-3,6,9,12,15,18-hexaoxanonadecan-1-ol
- 2,5,8,11,14,17-Hexaoxanonadecan-19-ol, 1,1-bis(4-methoxyphenyl)-1-phenyl-
- 3,6,9,12,15,18-Hexaoxanonadecan-1-ol, 19,19-bis(4-methoxyphenyl)-19-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
