
CAS 123707-27-7
:N-Methoxy-N,N′,N′-trimethylurea
Description:
N-Methoxy-N,N′,N′-trimethylurea is an organic compound characterized by its urea functional group, which is modified by the presence of a methoxy group and three methyl groups attached to the nitrogen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in polar solvents such as water and alcohols, which is indicative of its polar nature due to the presence of the methoxy group. N-Methoxy-N,N′,N′-trimethylurea is often used in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of pharmaceuticals. Its structure allows for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices.
Formula:C5H12N2O2
InChI:InChI=1S/C5H12N2O2/c1-6(2)5(8)7(3)9-4/h1-4H3
InChI key:InChIKey=VTLOQWKTMLAQKF-UHFFFAOYSA-N
SMILES:C(N(OC)C)(N(C)C)=O
Synonyms:- Urea, N-methoxy-N,N′,N′-trimethyl-
- Urea, methoxytrimethyl-
- N-Methoxy-N,N′,N′-trimethylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
