CymitQuimica logo

CAS 123708-42-9

:

N,N-Diethyl-2,1,3-benzothiadiazole-4-sulfonamide

Description:
N,N-Diethyl-2,1,3-benzothiadiazole-4-sulfonamide is a chemical compound characterized by its unique structure, which includes a benzothiadiazole moiety and a sulfonamide functional group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the sulfonamide group suggests that it may possess antibacterial or antifungal properties, making it of interest in medicinal chemistry. Additionally, the diethyl substituents can influence its lipophilicity and biological activity. The compound's CAS number, 123708-42-9, allows for easy identification in chemical databases and literature. As with many sulfonamides, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which can be leveraged for further synthetic applications. Overall, N,N-Diethyl-2,1,3-benzothiadiazole-4-sulfonamide is a versatile compound with potential utility in both research and industrial applications.
Formula:C10H13N3O2S2
InChI:InChI=1S/C10H13N3O2S2/c1-3-13(4-2)17(14,15)9-7-5-6-8-10(9)12-16-11-8/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=FIFIDXABBBQIDX-UHFFFAOYSA-N
SMILES:S(N(CC)CC)(=O)(=O)C=1C=2C(C=CC1)=NSN2
Synonyms:
  • 2,1,3-Benzothiadiazole-4-sulfonamide, N,N-diethyl-
  • N,N-Diethyl-2,1,3-benzothiadiazole-4-sulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.