CAS 123718-04-7

Ethyl 2-(ethoxycarbonyl)-2-cyclopentene-1-acetate

Description:

Ethyl 2-(ethoxycarbonyl)-2-cyclopentene-1-acetate is an organic compound characterized by its unique structure, which includes a cyclopentene ring and ester functional groups. This compound features an ethoxycarbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the acetate moiety indicates that it can undergo hydrolysis, making it useful in various chemical reactions. Typically, compounds like this exhibit moderate polarity due to the ester and ether functionalities, influencing their solubility in organic solvents. Ethyl 2-(ethoxycarbonyl)-2-cyclopentene-1-acetate may also demonstrate interesting chemical behavior, such as participating in cycloaddition reactions or serving as a precursor in the synthesis of more complex molecules. Its specific applications can vary, but it is often explored in the fields of medicinal chemistry and materials science. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₂H₁₈O₄

InChI: InChI=1S/C12H18O4/c1-3-15-11(13)8-9-6-5-7-10(9)12(14)16-4-2/h7,9H,3-6,8H2,1-2H3

InChI key: InChIKey=YMKYLUHCEFZOEG-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1C(C(OCC)=O)=CCC1

Synonyms:

• Ethyl 2-(ethoxycarbonyl)-2-cyclopentene-1-acetate
• 2-Cyclopentene-1-acetic acid, 2-(ethoxycarbonyl)-, ethyl ester, (±)-
• 2-Cyclopentene-1-acetic acid, 2-(ethoxycarbonyl)-, ethyl ester

2-Cyclopentene-1-acetic acid, 2-(ethoxycarbonyl)-, ethyl ester

CAS: 123718-04-7

Formula: C₁₂H₁₈O₄

Molecular weight: 226.2689

Ref: IN-DA000KZK