CAS 123743-85-1

2-Piperazinyl 3-(4-hydroxy-3-methoxyphenyl)-2-propenoate

Description:

2-Piperazinyl 3-(4-hydroxy-3-methoxyphenyl)-2-propenoate, identified by its CAS number 123743-85-1, is a chemical compound characterized by its piperazine moiety and a propenoate functional group. This compound features a phenolic structure with hydroxy and methoxy substituents, which contribute to its potential biological activity. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as solubility in polar solvents, and its structure indicates potential for hydrogen bonding due to the hydroxyl group. Additionally, the methoxy group can influence the electronic properties and reactivity of the molecule. Overall, 2-Piperazinyl 3-(4-hydroxy-3-methoxyphenyl)-2-propenoate is a complex organic compound that may have applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₄H₁₈N₂O₄

InChI: InChI=1S/C14H18N2O4/c1-19-12-8-10(2-4-11(12)17)3-5-14(18)20-13-9-15-6-7-16-13/h2-5,8,13,15-17H,6-7,9H2,1H3

InChI key: InChIKey=YDAWJUXLOBMHGW-UHFFFAOYSA-N

SMILES: C(=CC(OC1CNCCN1)=O)C2=CC(OC)=C(O)C=C2

Synonyms:

• 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, 2-piperazinyl ester
• 2-Piperazinyl 3-(4-hydroxy-3-methoxyphenyl)-2-propenoate

2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, 2-piperazinyl ester

CAS: 123743-85-1

Formula: C₁₄H₁₈N₂O₄

Molecular weight: 278.3037

Ref: IN-DA000L0X