
CAS 1237479-39-8
:Thieno[3,4-b]thiophene-2-carboxylic acid, 4,6-dibromo-3-fluoro-, 2-ethylhexyl ester, polymer with 1,1′-[4,8-bis[(2-ethylhexyl)oxy]benzo[1,2-b:4,5-b′]dithiophene-2,6-diyl]bis[1,1,1-trimethylstannane]
Description:
Thieno[3,4-b]thiophene-2-carboxylic acid, 4,6-dibromo-3-fluoro-, 2-ethylhexyl ester, polymer with 1,1′-[4,8-bis[(2-ethylhexyl)oxy]benzo[1,2-b:4,5-b′]dithiophene-2,6-diyl]bis[1,1,1-trimethylstannane] is a complex organic compound characterized by its unique structural features that include thieno and dithiophene units, which contribute to its electronic properties. This substance is typically used in organic electronics, particularly in organic photovoltaic devices and organic field-effect transistors, due to its ability to facilitate charge transport. The presence of bromine and fluorine atoms enhances its stability and solubility, while the ester functional group improves processability. The polymer's backbone structure allows for effective π-π stacking, which is crucial for optimizing charge mobility. Additionally, the incorporation of long alkyl chains, such as 2-ethylhexyl, aids in solubility in organic solvents, making it suitable for solution-processing techniques. Overall, this compound exhibits promising characteristics for applications in advanced materials science and organic semiconductor technology.
Formula:(C32H54O2S2Sn2·C15H17Br2FO2S2)x
InChI:InChI=1S/C26H36O2S2.C15H17Br2FO2S2.6CH3.2Sn/c1-5-9-11-19(7-3)17-27-23-21-13-15-30-26(21)24(22-14-16-29-25(22)23)28-18-20(8-4)12-10-6-2;1-3-5-6-8(4-2)7-20-15(19)12-10(18)9-11(21-12)14(17)22-13(9)16;;;;;;;;/h13-14,19-20H,5-12,17-18H2,1-4H3;8H,3-7H2,1-2H3;6*1H3;;
InChI key:InChIKey=SIDCIXJXCULLJO-UHFFFAOYSA-N
SMILES:FC=1C=2C(SC1C(OCC(CCCC)CC)=O)=C(Br)SC2Br.O(CC(CCCC)CC)C1=C2C(=C(OCC(CCCC)CC)C3=C1SC([Sn](C)(C)C)=C3)SC([Sn](C)(C)C)=C2
Synonyms:- Thieno[3,4-b]thiophene-2-carboxylic acid, 4,6-dibromo-3-fluoro-, 2-ethylhexyl ester, polymer with 1,1′-[4,8-bis[(2-ethylhexyl)oxy]benzo[1,2-b:4,5-b′]dithiophene-2,6-diyl]bis[1,1,1-trimethylstannane]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.