CAS 1237535-79-3
:5-Chloro-3,4-dihydro-1,8-naphthyridin-2(1H)-one
Description:
5-Chloro-3,4-dihydro-1,8-naphthyridin-2(1H)-one is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a chlorine atom at the 5-position and a carbonyl group at the 2-position contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as naphthyridine derivatives are often explored for their antimicrobial, anti-inflammatory, and anticancer properties. The compound's synthesis may involve multi-step organic reactions, and its stability can be influenced by factors such as pH and temperature. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, making it a versatile building block in organic synthesis.
Formula:C8H7ClN2O
InChI:InChI=1S/C8H7ClN2O/c9-6-3-4-10-8-5(6)1-2-7(12)11-8/h3-4H,1-2H2,(H,10,11,12)
InChI key:InChIKey=FLVDHGPUIZYARJ-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(=O)CC2)NC=C1
Synonyms:- 1,8-Naphthyridin-2(1H)-one, 5-chloro-3,4-dihydro-
- 5-Chloro-3,4-dihydro-1,8-naphthyridin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Chloro-3,4-dihydro-1,8-naphthyridin-2(1H)-one
CAS:Controlled ProductFormula:C8H7ClN2OColor and Shape:NeatMolecular weight:182.607
