CAS 123759-97-7
:10-Undecenoic acid, ester with 1,2,3-propanetriol
Description:
10-Undecenoic acid, ester with 1,2,3-propanetriol, commonly known as undecenoic acid triester, is a chemical compound characterized by its structure, which includes a long-chain fatty acid and a glycerol backbone. This compound is typically a colorless to pale yellow liquid with a mild odor. It is soluble in organic solvents and exhibits low solubility in water due to its hydrophobic nature. The presence of the undecenoic acid moiety imparts unsaturation to the molecule, which can influence its reactivity and physical properties, such as viscosity and melting point. This ester is often utilized in various applications, including cosmetics, food additives, and as a lubricant or surfactant in industrial formulations. Its properties make it suitable for use in formulations requiring emulsification or stabilization. Additionally, the compound may exhibit antimicrobial properties, making it of interest in the development of preservatives or antimicrobial agents. Overall, its unique structure and characteristics make it a versatile compound in both industrial and consumer products.
Formula:C11H20O2·xC3H8O3
InChI:InChI=1S/C11H20O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11(12)13;4-1-3(6)2-5/h2H,1,3-10H2,(H,12,13);3-6H,1-2H2
InChI key:InChIKey=HOKBFRWXBCORNN-UHFFFAOYSA-N
SMILES:C(CCCCC=C)CCCC(O)=O.C(CO)(CO)O
Synonyms:- Glyceryl undecylenate
- Glyceryl 10-undecylenate
- 10-Undecenoic acid, ester with 1,2,3-propanetriol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
