CAS 123770-62-7
:ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate
Description:
Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a hydroxymethyl group, which contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical reactions. The presence of the carboxylate moiety indicates that it can participate in esterification and other reactions typical of carboxylic acids. Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is of interest in medicinal chemistry and may exhibit biological activity, although specific pharmacological properties would require further investigation. Its CAS number, 123770-62-7, allows for easy identification in chemical databases and literature. Overall, this compound's unique structure and functional groups make it a valuable intermediate in the synthesis of more complex molecules.
Formula:C7H9NO4
InChI:InChI=1S/C7H9NO4/c1-2-11-7(10)6-3-5(4-9)12-8-6/h3,9H,2,4H2,1H3
InChI key:InChIKey=ZWVVVEYXDQMHGQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=C(CO)ON1
Synonyms:- 3-Isoxazolecarboxylic acid, 5-(hydroxymethyl)-, ethyl ester
- 5-(Hydroxymethyl)isoxazole-3-carboxylic acid ethyl ester
- Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate
- ethyl 5-(hydroxymethyl)-1,2-oxazole-3-carboxylate
- 5-(hydroxymethyl)-3-isoxazolecarboxylic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
ethyl 5-(hydroxymethyl)-1,2-oxazole-3-carboxylate
CAS:Formula:C7H9NO4Purity:95%Color and Shape:LiquidMolecular weight:171.1507Ref: IN-DA000L1K
50gTo inquire100gTo inquire250mg25.00€100mg26.00€1g57.00€5g141.00€10g192.00€25g592.00€Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate
CAS:Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate
Purity:0.95Molecular weight:171.15g/molEthyl 5-(hydroxymethyl)isoxazole-3-carboxylate
CAS:Formula:C7H9NO4Purity:95%Color and Shape:LiquidMolecular weight:171.152Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate
CAS:Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is a versatile compound with various applications. It is commonly used as a solvent for gadolinium and gadobutrol in medical imaging procedures. Additionally, it has antiviral properties and can be used in the synthesis of pharmaceuticals. This compound is miscible with many solvents including hydrogen fluoride, triclosan, and perchloroethylene. It can also be used in the synthesis of alkaloids, such as thymidylate and erythromycin. Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is widely utilized in research settings as a reagent for chemical reactions and crystallization processes. Its versatility makes it an essential component in various industries, including pharmaceuticals and research chemicals.Formula:C7H9NO4Purity:Min. 95%Molecular weight:171.15 g/mol



