CAS 123770-62-7

ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate

Description:

Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a hydroxymethyl group, which contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical reactions. The presence of the carboxylate moiety indicates that it can participate in esterification and other reactions typical of carboxylic acids. Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is of interest in medicinal chemistry and may exhibit biological activity, although specific pharmacological properties would require further investigation. Its CAS number, 123770-62-7, allows for easy identification in chemical databases and literature. Overall, this compound's unique structure and functional groups make it a valuable intermediate in the synthesis of more complex molecules.

Formula: C₇H₉NO₄

InChI: InChI=1S/C7H9NO4/c1-2-11-7(10)6-3-5(4-9)12-8-6/h3,9H,2,4H2,1H3

InChI key: InChIKey=ZWVVVEYXDQMHGQ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=C(CO)ON1

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-(hydroxymethyl)-, ethyl ester
• 5-(Hydroxymethyl)isoxazole-3-carboxylic acid ethyl ester
• Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate
• ethyl 5-(hydroxymethyl)-1,2-oxazole-3-carboxylate
• 5-(hydroxymethyl)-3-isoxazolecarboxylic acid ethyl ester

ethyl 5-(hydroxymethyl)-1,2-oxazole-3-carboxylate

CAS: 123770-62-7

Formula: C₇H₉NO₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 171.1507

Ref: IN-DA000L1K

Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate

CAS: 123770-62-7

Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate

Purity: 0.95

Molecular weight: 171.15g/mol

Ref: 54-OR300632

Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate

CAS: 123770-62-7

Formula: C₇H₉NO₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 171.152

Ref: 10-F449788

Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate

CAS: 123770-62-7

Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is a versatile compound with various applications. It is commonly used as a solvent for gadolinium and gadobutrol in medical imaging procedures. Additionally, it has antiviral properties and can be used in the synthesis of pharmaceuticals. This compound is miscible with many solvents including hydrogen fluoride, triclosan, and perchloroethylene. It can also be used in the synthesis of alkaloids, such as thymidylate and erythromycin. Ethyl 5-(hydroxymethyl)isoxazole-3-carboxylate is widely utilized in research settings as a reagent for chemical reactions and crystallization processes. Its versatility makes it an essential component in various industries, including pharmaceuticals and research chemicals.

Formula: C₇H₉NO₄

Purity: Min. 95%

Molecular weight: 171.15 g/mol

Ref: 3D-YEA77062