
CAS 123770-64-9
:2-Nitro-5-pyrimidinamine
Description:
2-Nitro-5-pyrimidinamine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a nitro group (-NO2) at the 2-position and an amino group (-NH2) at the 5-position contributes to its reactivity and potential applications in various chemical processes. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific functional groups and their interactions. It is often used in the synthesis of pharmaceuticals, agrochemicals, and other nitrogen-containing compounds due to its ability to participate in electrophilic substitution reactions. Safety considerations should be taken into account, as nitro compounds can be hazardous and may require careful handling and storage. Overall, 2-Nitro-5-pyrimidinamine is a valuable compound in organic synthesis and medicinal chemistry.
Formula:C4H4N4O2
InChI:InChI=1S/C4H4N4O2/c5-3-1-6-4(7-2-3)8(9)10/h1-2H,5H2
InChI key:InChIKey=LNZUVQSHOGIBFC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1N=CC(N)=CN1
Synonyms:- 5-Amino-2-nitropyrimidine
- 2-Nitro-5-pyrimidinamine
- 5-Pyrimidinamine, 2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.