CAS 1237838-84-4

Ethyl 6-chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate

Description:

Ethyl 6-chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a chloro and a trifluoromethyl group. This compound typically exhibits a range of properties, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylate functional group. The trifluoromethyl group often enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The imidazo[1,2-a]pyridine framework is known for its role in various pharmacological applications, including as a scaffold for drug development. Additionally, the presence of chlorine can affect the compound's electronic properties and stability. Overall, this compound's unique structural features may contribute to its potential utility in various chemical and pharmaceutical applications, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₁H₈ClF₃N₂O₂

InChI: InChI=1S/C11H8ClF3N2O2/c1-2-19-10(18)8-5-17-4-6(12)3-7(9(17)16-8)11(13,14)15/h3-5H,2H2,1H3

InChI key: InChIKey=BXFNMQMFEVSNPS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=2N(C=C(C(OCC)=O)N2)C=C(Cl)C1

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-chloro-8-(trifluoromethyl)-, ethyl ester
• 6-Chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid ethyl ester
• Ethyl 6-chloro-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate