
CAS 123784-08-7
:2-(4-Bromo-2-thienyl)pyridine
Description:
2-(4-Bromo-2-thienyl)pyridine is an organic compound characterized by its unique structure, which features a pyridine ring substituted with a 4-bromo-2-thienyl group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water. The presence of both bromine and sulfur in its structure contributes to its reactivity and potential applications in various chemical reactions, including cross-coupling reactions and as a building block in the synthesis of more complex molecules. It may also exhibit interesting electronic properties due to the conjugation between the thienyl and pyridine moieties. Additionally, compounds like this one are often investigated for their potential biological activities, including antimicrobial or anticancer properties. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-(4-Bromo-2-thienyl)pyridine is a valuable compound in organic synthesis and materials science.
Formula:C9H6BrNS
InChI:InChI=1S/C9H6BrNS/c10-7-5-9(12-6-7)8-3-1-2-4-11-8/h1-6H
InChI key:InChIKey=PTTNOIXNKYFOFH-UHFFFAOYSA-N
SMILES:BrC=1C=C(SC1)C2=CC=CC=N2
Synonyms:- 2-(4-Bromothiophen-2-yl)pyridine
- 2-(4-Bromo-2-thienyl)pyridine
- Pyridine, 2-(4-bromo-2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
