CAS 123788-44-3
:N-(5-bromopyridin-2-yl)-2-methylpropanamide
Description:
N-(5-bromopyridin-2-yl)-2-methylpropanamide is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a pyridine ring substituted with a bromine atom at the 5-position and an amide group attached to a branched alkyl chain, specifically 2-methylpropanamide. The presence of the bromine atom introduces notable electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The pyridine ring contributes to the compound's aromaticity and can influence its solubility and reactivity. Additionally, the branched alkyl chain can affect the steric hindrance and overall molecular interactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, N-(5-bromopyridin-2-yl)-2-methylpropanamide is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H11BrN2O
InChI:InChI=1/C9H11BrN2O/c1-6(2)9(13)12-8-4-3-7(10)5-11-8/h3-6H,1-2H3,(H,11,12,13)
SMILES:CC(C)C(=Nc1ccc(cn1)Br)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
