
CAS 123795-33-5
:Thiazole, 2-(decylthio)-4,5-dihydro-, hydrobromide (1:1)
Description:
Thiazole, 2-(decylthio)-4,5-dihydro-, hydrobromide (1:1) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of a decylthio group indicates that there is a decyl chain attached to the thiazole, contributing to its hydrophobic properties. The hydrobromide form suggests that the compound is a salt formed with hydrobromic acid, which can enhance its solubility in polar solvents. This compound may exhibit biological activity due to the thiazole moiety, which is often found in various pharmaceuticals and agrochemicals. Its molecular structure likely influences its physical properties, such as melting point and solubility, as well as its reactivity in chemical reactions. As with many thiazole derivatives, it may also possess potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature.
Formula:C13H25NS2·BrH
InChI:InChI=1S/C13H25NS2.BrH/c1-2-3-4-5-6-7-8-9-11-15-13-14-10-12-16-13;/h2-12H2,1H3;1H
InChI key:InChIKey=BEJVGOBUFYQSIN-UHFFFAOYSA-N
SMILES:S(CCCCCCCCCC)C1=NCCS1.Br
Synonyms:- Thiazole, 2-(decylthio)-4,5-dihydro-, hydrobromide
- Thiazole, 2-(decylthio)-4,5-dihydro-, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thiazole, 2-(decylthio)-4,5-dihydro-, hydrobromide (1:1)
CAS:Formula:C13H26BrNS2Molecular weight:340.3862
