CAS 1238-43-3

13b-Hydroxy-14-methyl-8,13,13b,14-tetrahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one

Description:

13b-Hydroxy-14-methyl-8,13,13b,14-tetrahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one, with CAS number 1238-43-3, is a complex organic compound characterized by its unique bicyclic structure that incorporates both indole and quinazoline moieties. This compound features a hydroxyl group at the 13b position and a methyl group at the 14 position, contributing to its chemical reactivity and potential biological activity. The presence of multiple fused rings suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. Its structural complexity may also influence its solubility, stability, and interaction with other molecules. While specific applications or biological activities may vary, compounds of this nature are often investigated for their potential use in medicinal chemistry, particularly in the development of therapeutic agents. Further studies would be necessary to elucidate its precise mechanisms of action and potential applications in drug development.

Formula: C₁₉H₁₇N₃O₂

InChI: InChI=1/C19H17N3O2/c1-21-16-9-5-3-7-14(16)18(23)22-11-10-13-12-6-2-4-8-15(12)20-17(13)19(21,22)24/h2-9,20,24H,10-11H2,1H3

SMILES: CN1c2ccccc2C(=O)N2CCc3c4ccccc4[nH]c3C12O

Synonyms:

• indolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one, 8,13,13b,14-tetrahydro-13b-hydroxy-14-methyl-
• Hydroxyl Evodiamine
• Hydroxyevodiamine

Hydroxyevodiamine

CAS: 1238-43-3

Hydroxyevodiamine is a natural product

Formula: C₁₉H₁₇N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 319.36

Ref: TM-TN1752

Hydroxy evodiamine

CAS: 1238-43-3

Hydroxy evodiamine is a bioactive alkaloid, which is derived from the fruit of the Evodia rutaecarpa plant, commonly known as Wu Zhu Yu. This compound is known for its diverse pharmacological activities, mediated primarily through interaction with various cellular signaling pathways. Hydroxy evodiamine functions by modulating neurotransmitter systems, particularly acting on serotonin and norepinephrine reuptake, which can influence mood regulation and has implications in central nervous system disorders.

Purity: Min. 95%

Ref: 3D-FH74179