CAS 123809-77-8
:1,2-Cyclopropanedimethanol, 1-acetate, (1R,2S)-
Description:
1,2-Cyclopropanedimethanol, 1-acetate, (1R,2S)- is an organic compound characterized by its cyclopropane structure, which features a three-membered carbon ring. This compound contains two hydroxymethyl groups (-CH2OH) and one acetate group (-OCOCH3) attached to the cyclopropane ring. The (1R,2S) designation indicates the specific stereochemistry of the molecule, which is crucial for its chemical behavior and potential biological activity. The presence of both hydroxyl and acetate functional groups suggests that this compound may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. Additionally, the acetate group can influence the reactivity of the molecule, potentially making it a useful intermediate in organic synthesis or in the development of pharmaceuticals. The compound's CAS number, 123809-77-8, allows for its identification in chemical databases and literature. Overall, the unique structure and functional groups of 1,2-Cyclopropanedimethanol, 1-acetate, (1R,2S)- contribute to its significance in various chemical applications.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c1-5(9)10-4-7-2-6(7)3-8/h6-8H,2-4H2,1H3/t6-,7+/m0/s1
InChI key:InChIKey=WQSPCCCSJFSVPD-NKWVEPMBSA-N
SMILES:C(OC(C)=O)[C@@H]1[C@H](CO)C1
Synonyms:- 1,2-Cyclopropanedimethanol, monoacetate, (1S,2R)-
- 1,2-Cyclopropanedimethanol, monoacetate, (1S-cis)-
- 1,2-Cyclopropanedimethanol, 1-acetate, (1R,2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
