CAS 123811-74-5
:2-Pyridinecarboxylic acid, 4-methoxy-, hydrochloride (1:1)
Description:
2-Pyridinecarboxylic acid, 4-methoxy-, hydrochloride (1:1), also known as 4-methoxy-2-pyridinecarboxylic acid hydrochloride, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group and a methoxy group (-OCH3) at the 4-position of the pyridine ring, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The presence of the methoxy group can influence the compound's reactivity and interaction with biological systems. It may exhibit properties such as acidity due to the carboxylic acid group and potential for hydrogen bonding. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C7H7NO3·ClH
InChI:InChI=1S/C7H7NO3.ClH/c1-11-5-2-3-8-6(4-5)7(9)10;/h2-4H,1H3,(H,9,10);1H
InChI key:InChIKey=ZQALTXNYLWROAB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(OC)=CC=N1.Cl
Synonyms:- 2-Pyridinecarboxylic acid, 4-methoxy-, hydrochloride
- 2-Pyridinecarboxylic acid, 4-methoxy-, hydrochloride (1:1)
- 4-Methoxy-2-pyridinecarboxylic acid hydrochloride
- 4-Methoxypicolinic Acid Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
