CAS 123812-78-2

cis-3-Fluorocyclobutanecarboxylic acid

Description:

Cis-3-Fluorocyclobutanecarboxylic acid is a cyclic carboxylic acid characterized by its unique four-membered cyclobutane ring structure, which incorporates a fluorine atom at the 3-position relative to the carboxylic acid functional group. This compound exhibits both polar and nonpolar characteristics due to the presence of the carboxylic acid group, which can engage in hydrogen bonding, and the fluorine atom, which can influence the compound's reactivity and stability. The cis configuration indicates that the substituents on the cyclobutane ring are oriented on the same side, affecting the compound's spatial arrangement and potentially its biological activity. The presence of the fluorine atom can enhance lipophilicity and alter the acidity compared to its non-fluorinated counterparts. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug design and synthesis. Its unique structural features make it a subject of study for understanding the effects of fluorination on chemical properties and reactivity.

Formula: C₅H₇FO₂

InChI: InChI=1/C5H7FO2/c6-4-1-3(2-4)5(7)8/h3-4H,1-2H2,(H,7,8)/t3-,4+

InChI key: InChIKey=LQXHCYIDZUPZNK-ZXZARUISNA-N

SMILES: C(O)(=O)[C@H]1C[C@@H](F)C1

Synonyms:

• Cyclobutanecarboxylic Acid, 3-Fluoro-, Cis-
• cis-3-Fluorocyclobutanecarboxylic acid

Cyclobutanecarboxylic acid, 3-fluoro-, cis-

CAS: 123812-78-2

Formula: C₅H₇FO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 118.1063

Ref: IN-DA000L4D

cis-3-Fluorocyclobutane-1-carboxylic acid

CAS: 123812-78-2

cis-3-Fluorocyclobutane-1-carboxylic acid

Purity: ≥95%

Molecular weight: 118.11g/mol

Ref: 54-PC411271

cis-3-fluorocyclobutane-1-carboxylic acid

CAS: 123812-78-2

Formula: C₅H₇FO₂

Purity: 97.0%

Molecular weight: 118.107

Ref: 10-F519199

cis-3-Fluorocyclobutane-1-carboxylic acid

CAS: 123812-78-2

Cis-3-Fluorocyclobutane-1-carboxylic acid is a highly versatile compound that serves as a chiral sensor for various applications. It can be used to detect and analyze fatty acids, aromatic hydrocarbons, and activated herbicides. This compound exhibits strong emission properties, making it an excellent choice for fluorescent probes in research studies. Additionally, cis-3-Fluorocyclobutane-1-carboxylic acid has been studied for its reactivity towards sarin and other reactive compounds. Its unique structure also allows it to interact with diisopropyl and diterpene compounds, as well as dopamine receptors. Furthermore, this compound has shown potential antiandrogenic properties in certain studies. With its wide range of applications and diverse characteristics, cis-3-Fluorocyclobutane-1-carboxylic acid is a valuable tool in the field of research chemicals.

Purity: Min. 95%

Ref: 3D-YEA81278