CymitQuimica logo

CAS 1238230-17-5

:

2,3-Dichloro-5-(trifluoromethyl)pyrazine

Description:
2,3-Dichloro-5-(trifluoromethyl)pyrazine is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of two chlorine atoms at the 2 and 3 positions and a trifluoromethyl group at the 5 position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is known for its potential applications in agrochemicals and pharmaceuticals due to its biological activity. It exhibits moderate to high stability under standard conditions, but like many halogenated compounds, it may undergo reactions such as nucleophilic substitution or electrophilic aromatic substitution. Its trifluoromethyl group enhances lipophilicity, which can influence its interaction with biological systems. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,3-Dichloro-5-(trifluoromethyl)pyrazine is a compound of interest in various fields of chemical research and development.
Formula:C5HCl2F3N2
InChI:InChI=1S/C5HCl2F3N2/c6-3-4(7)12-2(1-11-3)5(8,9)10/h1H
InChI key:InChIKey=QISCHXLTPQIMCO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NC(Cl)=C(Cl)N=C1
Synonyms:
  • 2,3-Dichloro-5-(trifluoromethyl)pyrazine
  • 2,3-Dichloro-5-trifluoromethylpyrazine
  • Pyrazine, 2,3-dichloro-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.